About 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-amine
5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-amine (PubChem CID 687260) has the molecular formula C8H7N3O2
and a molecular weight of 177.16 g/mol. Its IUPAC name is 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-amine.
Molecular Properties
| Compound Name | 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-amine |
| PubChem CID | 687260 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-amine |
| SMILES | Nc1no[n+]([O-])c1-c1ccccc1 |
| InChI | InChI=1S/C8H7N3O2/c9-8-7(11(12)13-10-8)6-4-2-1-3-5-6/h1-5H,(H2,9,10) |
| InChIKey | NAIAWBPXNSMQDE-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 78.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|
Analyze 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-amine?
The IUPAC name of 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-amine (CID 687260) is 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-amine.
What is the SMILES notation for 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-amine?
The canonical SMILES for 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-amine is Nc1no[n+]([O-])c1-c1ccccc1.
What is the InChIKey of 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-amine?
The InChIKey is NAIAWBPXNSMQDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2/c9-8-7(11(12)13-10-8)6-4-2-1-3-5-6/h1-5H,(H2,9,10).
What are the key properties of 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-amine?
5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-amine has a molecular weight of 177.16 g/mol, XLogP of 0.56, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-amine is sourced from PubChem (CID 687260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).