1H-pyrazol-5-amine;2,2,2-trifluoroacetic acid

C5H6F3N3O2 — CID 68726267

IUPAC1H-pyrazol-5-amine;2,2,2-trifluoroacetic acid
SMILESNc1ccn[nH]1.O=C(O)C(F)(F)F
InChIInChI=1S/C3H5N3.C2HF3O2/c4-3-1-2-5-6-3;3-2(4,5)1(6)7/h1-2H,(H3,4,5,6);(H,6,7)
InChIKeyDIZQRNPJLQXEOC-UHFFFAOYSA-N
MW197.12 g/mol
LogP0.63
Rot. Bonds

About 1H-pyrazol-5-amine;2,2,2-trifluoroacetic acid

1H-pyrazol-5-amine;2,2,2-trifluoroacetic acid (PubChem CID 68726267) has the molecular formula C5H6F3N3O2 and a molecular weight of 197.12 g/mol. Its IUPAC name is 1H-pyrazol-5-amine;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name1H-pyrazol-5-amine;2,2,2-trifluoroacetic acid
PubChem CID68726267
Molecular FormulaC5H6F3N3O2
Molecular Weight197.12 g/mol
Exact Mass197.04
IUPAC Name1H-pyrazol-5-amine;2,2,2-trifluoroacetic acid
SMILESNc1ccn[nH]1.O=C(O)C(F)(F)F
InChIInChI=1S/C3H5N3.C2HF3O2/c4-3-1-2-5-6-3;3-2(4,5)1(6)7/h1-2H,(H3,4,5,6);(H,6,7)
InChIKeyDIZQRNPJLQXEOC-UHFFFAOYSA-N
XLogP0.63
TPSA92.00 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.12
LogP ≤ 50.63
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 1H-pyrazol-5-amine;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1H-pyrazol-5-amine;2,2,2-trifluoroacetic acid?
The IUPAC name of 1H-pyrazol-5-amine;2,2,2-trifluoroacetic acid (CID 68726267) is 1H-pyrazol-5-amine;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 1H-pyrazol-5-amine;2,2,2-trifluoroacetic acid?
The canonical SMILES for 1H-pyrazol-5-amine;2,2,2-trifluoroacetic acid is Nc1ccn[nH]1.O=C(O)C(F)(F)F.
What is the InChIKey of 1H-pyrazol-5-amine;2,2,2-trifluoroacetic acid?
The InChIKey is DIZQRNPJLQXEOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5N3.C2HF3O2/c4-3-1-2-5-6-3;3-2(4,5)1(6)7/h1-2H,(H3,4,5,6);(H,6,7).
What are the key properties of 1H-pyrazol-5-amine;2,2,2-trifluoroacetic acid?
1H-pyrazol-5-amine;2,2,2-trifluoroacetic acid has a molecular weight of 197.12 g/mol, XLogP of 0.63, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazol-5-amine;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 68726267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).