About 2-carboxy-1,3-difluoro-4-[propyl(sulfinato)amino]benzene
2-carboxy-1,3-difluoro-4-[propyl(sulfinato)amino]benzene (PubChem CID 68726268) has the molecular formula C10H10F2NO4S-
and a molecular weight of 278.26 g/mol. Its IUPAC name is 2-carboxy-1,3-difluoro-4-[propyl(sulfinato)amino]benzene.
Molecular Properties
| Compound Name | 2-carboxy-1,3-difluoro-4-[propyl(sulfinato)amino]benzene |
| PubChem CID | 68726268 |
| Molecular Formula | C10H10F2NO4S- |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 2-carboxy-1,3-difluoro-4-[propyl(sulfinato)amino]benzene |
| SMILES | CCCN(c1ccc(F)c(C(=O)O)c1F)S(=O)[O-] |
| InChI | InChI=1S/C10H11F2NO4S/c1-2-5-13(18(16)17)7-4-3-6(11)8(9(7)12)10(14)15/h3-4H,2,5H2,1H3,(H,14,15)(H,16,17)/p-1 |
| InChIKey | LHDKRYWTBHVBKY-UHFFFAOYSA-M |
| XLogP | 1.67 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-carboxy-1,3-difluoro-4-[propyl(sulfinato)amino]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carboxy-1,3-difluoro-4-[propyl(sulfinato)amino]benzene?
The IUPAC name of 2-carboxy-1,3-difluoro-4-[propyl(sulfinato)amino]benzene (CID 68726268) is 2-carboxy-1,3-difluoro-4-[propyl(sulfinato)amino]benzene.
What is the SMILES notation for 2-carboxy-1,3-difluoro-4-[propyl(sulfinato)amino]benzene?
The canonical SMILES for 2-carboxy-1,3-difluoro-4-[propyl(sulfinato)amino]benzene is CCCN(c1ccc(F)c(C(=O)O)c1F)S(=O)[O-].
What is the InChIKey of 2-carboxy-1,3-difluoro-4-[propyl(sulfinato)amino]benzene?
The InChIKey is LHDKRYWTBHVBKY-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H11F2NO4S/c1-2-5-13(18(16)17)7-4-3-6(11)8(9(7)12)10(14)15/h3-4H,2,5H2,1H3,(H,14,15)(H,16,17)/p-1.
What are the key properties of 2-carboxy-1,3-difluoro-4-[propyl(sulfinato)amino]benzene?
2-carboxy-1,3-difluoro-4-[propyl(sulfinato)amino]benzene has a molecular weight of 278.26 g/mol, XLogP of 1.67, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carboxy-1,3-difluoro-4-[propyl(sulfinato)amino]benzene is sourced from PubChem (CID 68726268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).