C13H16N2 — CID 687265
2,7-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 687265) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2,7-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 2,7-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 687265 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2,7-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | Cc1ccc2c3c([nH]c2c1)CCN(C)C3 |
| InChI | InChI=1S/C13H16N2/c1-9-3-4-10-11-8-15(2)6-5-12(11)14-13(10)7-9/h3-4,7,14H,5-6,8H2,1-2H3 |
| InChIKey | KMOQRWCHESCPKL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|