C15H12ClF3NO4S2- — CID 68726706
2-chloro-5-[sulfinato-(4,4,4-trifluoro-1-methoxy-1-oxo-3-phenylbutan-2-yl)amino]thiophene (PubChem CID 68726706) has the molecular formula C15H12ClF3NO4S2- and a molecular weight of 426.85 g/mol. Its IUPAC name is 2-chloro-5-[sulfinato-(4,4,4-trifluoro-1-methoxy-1-oxo-3-phenylbutan-2-yl)amino]thiophene.
| Compound Name | 2-chloro-5-[sulfinato-(4,4,4-trifluoro-1-methoxy-1-oxo-3-phenylbutan-2-yl)amino]thiophene |
|---|---|
| PubChem CID | 68726706 |
| Molecular Formula | C15H12ClF3NO4S2- |
| Molecular Weight | 426.85 g/mol |
| Exact Mass | 425.99 |
| IUPAC Name | 2-chloro-5-[sulfinato-(4,4,4-trifluoro-1-methoxy-1-oxo-3-phenylbutan-2-yl)amino]thiophene |
| SMILES | COC(=O)C(C(c1ccccc1)C(F)(F)F)N(c1ccc(Cl)s1)S(=O)[O-] |
| InChI | InChI=1S/C15H13ClF3NO4S2/c1-24-14(21)13(20(26(22)23)11-8-7-10(16)25-11)12(15(17,18)19)9-5-3-2-4-6-9/h2-8,12-13H,1H3,(H,22,23)/p-1 |
| InChIKey | QAAJDHMEWOGLJF-UHFFFAOYSA-M |
| XLogP | 3.89 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.85 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|