C14H23BO4 — CID 68726848
2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]acetic acid (PubChem CID 68726848) has the molecular formula C14H23BO4 and a molecular weight of 266.15 g/mol. Its IUPAC name is 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]acetic acid.
| Compound Name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 68726848 |
| Molecular Formula | C14H23BO4 |
| Molecular Weight | 266.15 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]acetic acid |
| SMILES | CC1(C)OB(C2=CCC(CC(=O)O)CC2)OC1(C)C |
| InChI | InChI=1S/C14H23BO4/c1-13(2)14(3,4)19-15(18-13)11-7-5-10(6-8-11)9-12(16)17/h7,10H,5-6,8-9H2,1-4H3,(H,16,17) |
| InChIKey | DCQPMDQDSOPZKB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.15 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|