C14H17NO3 — CID 68726884
5-cyclohexa-1,3-dien-1-yl-N-propyl-1,4-dioxine-2-carboxamide (PubChem CID 68726884) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 5-cyclohexa-1,3-dien-1-yl-N-propyl-1,4-dioxine-2-carboxamide.
| Compound Name | 5-cyclohexa-1,3-dien-1-yl-N-propyl-1,4-dioxine-2-carboxamide |
|---|---|
| PubChem CID | 68726884 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 5-cyclohexa-1,3-dien-1-yl-N-propyl-1,4-dioxine-2-carboxamide |
| SMILES | CCCNC(=O)C1=COC(C2=CC=CCC2)=CO1 |
| InChI | InChI=1S/C14H17NO3/c1-2-8-15-14(16)13-10-17-12(9-18-13)11-6-4-3-5-7-11/h3-4,6,9-10H,2,5,7-8H2,1H3,(H,15,16) |
| InChIKey | OXJHYQXHBMLGIT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |