C20H20F3N3O3 — CID 68726954
4-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]methylcarbamoyl]benzoic acid (PubChem CID 68726954) has the molecular formula C20H20F3N3O3 and a molecular weight of 407.39 g/mol. Its IUPAC name is 4-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]methylcarbamoyl]benzoic acid.
| Compound Name | 4-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]methylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 68726954 |
| Molecular Formula | C20H20F3N3O3 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 4-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]methylcarbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)NCC2CCN(c3ccc(C(F)(F)F)cn3)CC2)cc1 |
| InChI | InChI=1S/C20H20F3N3O3/c21-20(22,23)16-5-6-17(24-12-16)26-9-7-13(8-10-26)11-25-18(27)14-1-3-15(4-2-14)19(28)29/h1-6,12-13H,7-11H2,(H,25,27)(H,28,29) |
| InChIKey | LKOLHMUMCFDDNN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |