C12H16N2O — CID 68727532
1,4,4a,5,6,6a,9,11a-octahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one (PubChem CID 68727532) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 1,4,4a,5,6,6a,9,11a-octahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one.
| Compound Name | 1,4,4a,5,6,6a,9,11a-octahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
|---|---|
| PubChem CID | 68727532 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1,4,4a,5,6,6a,9,11a-octahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| SMILES | O=C1C2CC=CCC2NCC2C=CCN12 |
| InChI | InChI=1S/C12H16N2O/c15-12-10-5-1-2-6-11(10)13-8-9-4-3-7-14(9)12/h1-4,9-11,13H,5-8H2 |
| InChIKey | QATGXCDGJSTQPR-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|