C15H19NO6 — CID 68727951
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(2-methyl-1H-indol-3-yl)oxy]oxane-3,4,5-triol (PubChem CID 68727951) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(2-methyl-1H-indol-3-yl)oxy]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(2-methyl-1H-indol-3-yl)oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 68727951 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(2-methyl-1H-indol-3-yl)oxy]oxane-3,4,5-triol |
| SMILES | Cc1[nH]c2ccccc2c1O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H19NO6/c1-7-14(8-4-2-3-5-9(8)16-7)22-15-13(20)12(19)11(18)10(6-17)21-15/h2-5,10-13,15-20H,6H2,1H3/t10-,11+,12+,13-,15+/m1/s1 |
| InChIKey | SCSFXMQKFUYFPS-KDBYPZKRSA-N |
| XLogP | -0.34 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |