C26H29N3O2S — CID 68728197
2-[3-(benzenesulfonyl)quinolin-8-yl]-1,3,4,4a,5,5a,6,7,8,9,9a,9b-dodecahydropyrido[4,3-b]indole (PubChem CID 68728197) has the molecular formula C26H29N3O2S and a molecular weight of 447.60 g/mol. Its IUPAC name is 2-[3-(benzenesulfonyl)quinolin-8-yl]-1,3,4,4a,5,5a,6,7,8,9,9a,9b-dodecahydropyrido[4,3-b]indole.
| Compound Name | 2-[3-(benzenesulfonyl)quinolin-8-yl]-1,3,4,4a,5,5a,6,7,8,9,9a,9b-dodecahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 68728197 |
| Molecular Formula | C26H29N3O2S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 2-[3-(benzenesulfonyl)quinolin-8-yl]-1,3,4,4a,5,5a,6,7,8,9,9a,9b-dodecahydropyrido[4,3-b]indole |
| SMILES | O=S(=O)(c1ccccc1)c1cnc2c(N3CCC4NC5CCCCC5C4C3)cccc2c1 |
| InChI | InChI=1S/C26H29N3O2S/c30-32(31,19-8-2-1-3-9-19)20-15-18-7-6-12-25(26(18)27-16-20)29-14-13-24-22(17-29)21-10-4-5-11-23(21)28-24/h1-3,6-9,12,15-16,21-24,28H,4-5,10-11,13-14,17H2 |
| InChIKey | KLFYHYCCNSXEKH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |