About CID 68728345
CID 68728345 (PubChem CID 68728345) has the molecular formula C9H11NSi
and a molecular weight of 161.28 g/mol.
Molecular Properties
| Compound Name | CID 68728345 |
| PubChem CID | 68728345 |
| Molecular Formula | C9H11NSi |
| Molecular Weight | 161.28 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | — |
| SMILES | CC=C(C)[Si]c1ccccn1 |
| InChI | InChI=1S/C9H11NSi/c1-3-8(2)11-9-6-4-5-7-10-9/h3-7H,1-2H3 |
| InChIKey | CQOZKNKCDUJDFO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 68728345 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68728345?
The IUPAC name of CID 68728345 (CID 68728345) is not available.
What is the SMILES notation for CID 68728345?
The canonical SMILES for CID 68728345 is CC=C(C)[Si]c1ccccn1.
What is the InChIKey of CID 68728345?
The InChIKey is CQOZKNKCDUJDFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NSi/c1-3-8(2)11-9-6-4-5-7-10-9/h3-7H,1-2H3.
What are the key properties of CID 68728345?
CID 68728345 has a molecular weight of 161.28 g/mol, XLogP of 1.33, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68728345 is sourced from PubChem (CID 68728345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).