C24H32N6O4S — CID 68728693
(1R,2R,3S,5R)-3-[5-butylsulfanyl-7-[(2-phenylcyclopropyl)amino]triazolo[4,5-d]pyrimidin-3-yl]-5-(2-hydroxyethoxy)cyclopentane-1,2-diol (PubChem CID 68728693) has the molecular formula C24H32N6O4S and a molecular weight of 500.63 g/mol. Its IUPAC name is (1R,2R,3S,5R)-3-[5-butylsulfanyl-7-[(2-phenylcyclopropyl)amino]triazolo[4,5-d]pyrimidin-3-yl]-5-(2-hydroxyethoxy)cyclopentane-1,2-diol.
| Compound Name | (1R,2R,3S,5R)-3-[5-butylsulfanyl-7-[(2-phenylcyclopropyl)amino]triazolo[4,5-d]pyrimidin-3-yl]-5-(2-hydroxyethoxy)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 68728693 |
| Molecular Formula | C24H32N6O4S |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | (1R,2R,3S,5R)-3-[5-butylsulfanyl-7-[(2-phenylcyclopropyl)amino]triazolo[4,5-d]pyrimidin-3-yl]-5-(2-hydroxyethoxy)cyclopentane-1,2-diol |
| SMILES | CCCCSc1nc(NC2CC2c2ccccc2)c2nnn([C@H]3C[C@@H](OCCO)[C@H](O)[C@@H]3O)c2n1 |
| InChI | InChI=1S/C24H32N6O4S/c1-2-3-11-35-24-26-22(25-16-12-15(16)14-7-5-4-6-8-14)19-23(27-24)30(29-28-19)17-13-18(34-10-9-31)21(33)20(17)32/h4-8,15-18,20-21,31-33H,2-3,9-13H2,1H3,(H,25,26,27)/t15?,16?,17-,18+,20+,21-/m0/s1 |
| InChIKey | FGDIDDXSQBCGOX-WGVYTRJYSA-N |
| XLogP | 2.13 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|