C10H10O2 — CID 68729379
2,3,3a,4-tetrahydrofuro[2,3-e][1]benzofuran (PubChem CID 68729379) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is 2,3,3a,4-tetrahydrofuro[2,3-e][1]benzofuran.
| Compound Name | 2,3,3a,4-tetrahydrofuro[2,3-e][1]benzofuran |
|---|---|
| PubChem CID | 68729379 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 2,3,3a,4-tetrahydrofuro[2,3-e][1]benzofuran |
| SMILES | C1=c2occc2=C2OCCC2C1 |
| InChI | InChI=1S/C10H10O2/c1-2-9-8(4-6-11-9)10-7(1)3-5-12-10/h2,4,6-7H,1,3,5H2 |
| InChIKey | VOCIDCRQVWWXDF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |