About 5-bromo-3-methyl-1,2-dihydropyridin-2-amine
5-bromo-3-methyl-1,2-dihydropyridin-2-amine (PubChem CID 68729459) has the molecular formula C6H9BrN2
and a molecular weight of 189.06 g/mol. Its IUPAC name is 5-bromo-3-methyl-1,2-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | 5-bromo-3-methyl-1,2-dihydropyridin-2-amine |
| PubChem CID | 68729459 |
| Molecular Formula | C6H9BrN2 |
| Molecular Weight | 189.06 g/mol |
| Exact Mass | 187.99 |
| IUPAC Name | 5-bromo-3-methyl-1,2-dihydropyridin-2-amine |
| SMILES | CC1=CC(Br)=CNC1N |
| InChI | InChI=1S/C6H9BrN2/c1-4-2-5(7)3-9-6(4)8/h2-3,6,9H,8H2,1H3 |
| InChIKey | XTEOXRWIVBVGRD-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.06 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-3-methyl-1,2-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-methyl-1,2-dihydropyridin-2-amine?
The IUPAC name of 5-bromo-3-methyl-1,2-dihydropyridin-2-amine (CID 68729459) is 5-bromo-3-methyl-1,2-dihydropyridin-2-amine.
What is the SMILES notation for 5-bromo-3-methyl-1,2-dihydropyridin-2-amine?
The canonical SMILES for 5-bromo-3-methyl-1,2-dihydropyridin-2-amine is CC1=CC(Br)=CNC1N.
What is the InChIKey of 5-bromo-3-methyl-1,2-dihydropyridin-2-amine?
The InChIKey is XTEOXRWIVBVGRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrN2/c1-4-2-5(7)3-9-6(4)8/h2-3,6,9H,8H2,1H3.
What are the key properties of 5-bromo-3-methyl-1,2-dihydropyridin-2-amine?
5-bromo-3-methyl-1,2-dihydropyridin-2-amine has a molecular weight of 189.06 g/mol, XLogP of 1.06, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-methyl-1,2-dihydropyridin-2-amine is sourced from PubChem (CID 68729459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).