C19H20FN3O4S3 — CID 68730060
[1-[4-(2-fluoro-3-pyridinyl)-5-(1,3-thiazol-2-ylsulfonyl)thiophen-2-yl]-3,3-dimethylbutan-2-yl]carbamic acid (PubChem CID 68730060) has the molecular formula C19H20FN3O4S3 and a molecular weight of 469.59 g/mol. Its IUPAC name is [1-[4-(2-fluoro-3-pyridinyl)-5-(1,3-thiazol-2-ylsulfonyl)thiophen-2-yl]-3,3-dimethylbutan-2-yl]carbamic acid.
| Compound Name | [1-[4-(2-fluoro-3-pyridinyl)-5-(1,3-thiazol-2-ylsulfonyl)thiophen-2-yl]-3,3-dimethylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 68730060 |
| Molecular Formula | C19H20FN3O4S3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | [1-[4-(2-fluoro-3-pyridinyl)-5-(1,3-thiazol-2-ylsulfonyl)thiophen-2-yl]-3,3-dimethylbutan-2-yl]carbamic acid |
| SMILES | CC(C)(C)C(Cc1cc(-c2cccnc2F)c(S(=O)(=O)c2nccs2)s1)NC(=O)O |
| InChI | InChI=1S/C19H20FN3O4S3/c1-19(2,3)14(23-17(24)25)10-11-9-13(12-5-4-6-21-15(12)20)16(29-11)30(26,27)18-22-7-8-28-18/h4-9,14,23H,10H2,1-3H3,(H,24,25) |
| InChIKey | HRGFQVOUTUEKQE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|