C12H11ClFN3OS2 — CID 68730271
1-(4-chloro-2-fluoro-5-sulfanylphenyl)imino-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-3-one (PubChem CID 68730271) has the molecular formula C12H11ClFN3OS2 and a molecular weight of 331.83 g/mol. Its IUPAC name is 1-(4-chloro-2-fluoro-5-sulfanylphenyl)imino-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-3-one.
| Compound Name | 1-(4-chloro-2-fluoro-5-sulfanylphenyl)imino-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-3-one |
|---|---|
| PubChem CID | 68730271 |
| Molecular Formula | C12H11ClFN3OS2 |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 1-(4-chloro-2-fluoro-5-sulfanylphenyl)imino-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-3-one |
| SMILES | O=c1s/c(=N\c2cc(S)c(Cl)cc2F)n2n1CCCC2 |
| InChI | InChI=1S/C12H11ClFN3OS2/c13-7-5-8(14)9(6-10(7)19)15-11-16-3-1-2-4-17(16)12(18)20-11/h5-6,19H,1-4H2/b15-11- |
| InChIKey | RQOMONFJGBRCSU-PTNGSMBKSA-N |
| XLogP | 2.82 |
| TPSA | 39.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|