About [1-methoxy-1-(2,3,4-trifluorophenyl)ethyl]carbamic acid
[1-methoxy-1-(2,3,4-trifluorophenyl)ethyl]carbamic acid (PubChem CID 68730994) has the molecular formula C10H10F3NO3
and a molecular weight of 249.19 g/mol. Its IUPAC name is [1-methoxy-1-(2,3,4-trifluorophenyl)ethyl]carbamic acid.
Molecular Properties
| Compound Name | [1-methoxy-1-(2,3,4-trifluorophenyl)ethyl]carbamic acid |
| PubChem CID | 68730994 |
| Molecular Formula | C10H10F3NO3 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | [1-methoxy-1-(2,3,4-trifluorophenyl)ethyl]carbamic acid |
| SMILES | COC(C)(NC(=O)O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C10H10F3NO3/c1-10(17-2,14-9(15)16)5-3-4-6(11)8(13)7(5)12/h3-4,14H,1-2H3,(H,15,16) |
| InChIKey | YBTMNEOCMACEEP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [1-methoxy-1-(2,3,4-trifluorophenyl)ethyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-methoxy-1-(2,3,4-trifluorophenyl)ethyl]carbamic acid?
The IUPAC name of [1-methoxy-1-(2,3,4-trifluorophenyl)ethyl]carbamic acid (CID 68730994) is [1-methoxy-1-(2,3,4-trifluorophenyl)ethyl]carbamic acid.
What is the SMILES notation for [1-methoxy-1-(2,3,4-trifluorophenyl)ethyl]carbamic acid?
The canonical SMILES for [1-methoxy-1-(2,3,4-trifluorophenyl)ethyl]carbamic acid is COC(C)(NC(=O)O)c1ccc(F)c(F)c1F.
What is the InChIKey of [1-methoxy-1-(2,3,4-trifluorophenyl)ethyl]carbamic acid?
The InChIKey is YBTMNEOCMACEEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3NO3/c1-10(17-2,14-9(15)16)5-3-4-6(11)8(13)7(5)12/h3-4,14H,1-2H3,(H,15,16).
What are the key properties of [1-methoxy-1-(2,3,4-trifluorophenyl)ethyl]carbamic acid?
[1-methoxy-1-(2,3,4-trifluorophenyl)ethyl]carbamic acid has a molecular weight of 249.19 g/mol, XLogP of 2.19, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-methoxy-1-(2,3,4-trifluorophenyl)ethyl]carbamic acid is sourced from PubChem (CID 68730994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).