C30H32F3N9O2 — CID 68731159
1-[4-(4-methylpiperazin-1-yl)phenyl]-3-[4-[4-[2,2,2-trifluoro-1-[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]ethyl]-1H-pyrazolo[3,4-d]pyrimidin-6-yl]phenyl]urea (PubChem CID 68731159) has the molecular formula C30H32F3N9O2 and a molecular weight of 607.64 g/mol. Its IUPAC name is 1-[4-(4-methylpiperazin-1-yl)phenyl]-3-[4-[4-[2,2,2-trifluoro-1-[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]ethyl]-1H-pyrazolo[3,4-d]pyrimidin-6-yl]phenyl]urea.
| Compound Name | 1-[4-(4-methylpiperazin-1-yl)phenyl]-3-[4-[4-[2,2,2-trifluoro-1-[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]ethyl]-1H-pyrazolo[3,4-d]pyrimidin-6-yl]phenyl]urea |
|---|---|
| PubChem CID | 68731159 |
| Molecular Formula | C30H32F3N9O2 |
| Molecular Weight | 607.64 g/mol |
| Exact Mass | 607.26 |
| IUPAC Name | 1-[4-(4-methylpiperazin-1-yl)phenyl]-3-[4-[4-[2,2,2-trifluoro-1-[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]ethyl]-1H-pyrazolo[3,4-d]pyrimidin-6-yl]phenyl]urea |
| SMILES | CN1CCN(c2ccc(NC(=O)Nc3ccc(-c4nc(C(N5C[C@H]6C[C@@H]5CO6)C(F)(F)F)c5cn[nH]c5n4)cc3)cc2)CC1 |
| InChI | InChI=1S/C30H32F3N9O2/c1-40-10-12-41(13-11-40)21-8-6-20(7-9-21)36-29(43)35-19-4-2-18(3-5-19)27-37-25(24-15-34-39-28(24)38-27)26(30(31,32)33)42-16-23-14-22(42)17-44-23/h2-9,15,22-23,26H,10-14,16-17H2,1H3,(H2,35,36,43)(H,34,37,38,39)/t22-,23-,26?/m1/s1 |
| InChIKey | CYBGPTGMLLSCSU-JIISWEIGSA-N |
| XLogP | 4.49 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.64 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|