C29H36FN3O3 — CID 68731163
4-[2-[(3R)-1-cyclobutylpyrrolidin-3-yl]-1-oxo-3,4-dihydroisoquinolin-6-yl]-3-fluoro-N-(2-propan-2-yloxyethyl)benzamide (PubChem CID 68731163) has the molecular formula C29H36FN3O3 and a molecular weight of 493.62 g/mol. Its IUPAC name is 4-[2-[(3R)-1-cyclobutylpyrrolidin-3-yl]-1-oxo-3,4-dihydroisoquinolin-6-yl]-3-fluoro-N-(2-propan-2-yloxyethyl)benzamide.
| Compound Name | 4-[2-[(3R)-1-cyclobutylpyrrolidin-3-yl]-1-oxo-3,4-dihydroisoquinolin-6-yl]-3-fluoro-N-(2-propan-2-yloxyethyl)benzamide |
|---|---|
| PubChem CID | 68731163 |
| Molecular Formula | C29H36FN3O3 |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | 4-[2-[(3R)-1-cyclobutylpyrrolidin-3-yl]-1-oxo-3,4-dihydroisoquinolin-6-yl]-3-fluoro-N-(2-propan-2-yloxyethyl)benzamide |
| SMILES | CC(C)OCCNC(=O)c1ccc(-c2ccc3c(c2)CCN([C@@H]2CCN(C4CCC4)C2)C3=O)c(F)c1 |
| InChI | InChI=1S/C29H36FN3O3/c1-19(2)36-15-12-31-28(34)22-7-8-25(27(30)17-22)20-6-9-26-21(16-20)10-14-33(29(26)35)24-11-13-32(18-24)23-4-3-5-23/h6-9,16-17,19,23-24H,3-5,10-15,18H2,1-2H3,(H,31,34)/t24-/m1/s1 |
| InChIKey | SIELAOOTXUGQLI-XMMPIXPASA-N |
| XLogP | 4.27 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|