C21H21F3N2O — CID 68731437
5,5,5-trifluoro-2,4-dimethyl-4-pyridin-4-yl-1-quinolin-4-ylpentan-2-ol (PubChem CID 68731437) has the molecular formula C21H21F3N2O and a molecular weight of 374.41 g/mol. Its IUPAC name is 5,5,5-trifluoro-2,4-dimethyl-4-pyridin-4-yl-1-quinolin-4-ylpentan-2-ol.
| Compound Name | 5,5,5-trifluoro-2,4-dimethyl-4-pyridin-4-yl-1-quinolin-4-ylpentan-2-ol |
|---|---|
| PubChem CID | 68731437 |
| Molecular Formula | C21H21F3N2O |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 5,5,5-trifluoro-2,4-dimethyl-4-pyridin-4-yl-1-quinolin-4-ylpentan-2-ol |
| SMILES | CC(O)(Cc1ccnc2ccccc12)CC(C)(c1ccncc1)C(F)(F)F |
| InChI | InChI=1S/C21H21F3N2O/c1-19(27,13-15-7-12-26-18-6-4-3-5-17(15)18)14-20(2,21(22,23)24)16-8-10-25-11-9-16/h3-12,27H,13-14H2,1-2H3 |
| InChIKey | QHKBQHCDLBDAJX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |