C26H27ClN4 — CID 6873146
(E)-N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(9-ethylcarbazol-3-yl)methanimine (PubChem CID 6873146) has the molecular formula C26H27ClN4 and a molecular weight of 430.98 g/mol. Its IUPAC name is (E)-N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(9-ethylcarbazol-3-yl)methanimine.
| Compound Name | (E)-N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(9-ethylcarbazol-3-yl)methanimine |
|---|---|
| PubChem CID | 6873146 |
| Molecular Formula | C26H27ClN4 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | (E)-N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(9-ethylcarbazol-3-yl)methanimine |
| SMILES | CCn1c2ccccc2c2cc(/C=N/N3CCN(Cc4ccc(Cl)cc4)CC3)ccc21 |
| InChI | InChI=1S/C26H27ClN4/c1-2-31-25-6-4-3-5-23(25)24-17-21(9-12-26(24)31)18-28-30-15-13-29(14-16-30)19-20-7-10-22(27)11-8-20/h3-12,17-18H,2,13-16,19H2,1H3/b28-18+ |
| InChIKey | UKLUKQFXADFNPT-MTDXEUNCSA-N |
| XLogP | 5.62 |
| TPSA | 23.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|