About [3,6-diamino-4-(1-benzofuran-5-yl)-5-cyanothieno[2,3-b]pyridin-2-yl] carbamate
[3,6-diamino-4-(1-benzofuran-5-yl)-5-cyanothieno[2,3-b]pyridin-2-yl] carbamate (PubChem CID 68731683) has the molecular formula C17H11N5O3S
and a molecular weight of 365.37 g/mol. Its IUPAC name is [3,6-diamino-4-(1-benzofuran-5-yl)-5-cyanothieno[2,3-b]pyridin-2-yl] carbamate.
Molecular Properties
| Compound Name | [3,6-diamino-4-(1-benzofuran-5-yl)-5-cyanothieno[2,3-b]pyridin-2-yl] carbamate |
| PubChem CID | 68731683 |
| Molecular Formula | C17H11N5O3S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | [3,6-diamino-4-(1-benzofuran-5-yl)-5-cyanothieno[2,3-b]pyridin-2-yl] carbamate |
| SMILES | N#Cc1c(N)nc2sc(OC(N)=O)c(N)c2c1-c1ccc2occc2c1 |
| InChI | InChI=1S/C17H11N5O3S/c18-6-9-11(8-1-2-10-7(5-8)3-4-24-10)12-13(19)16(25-17(21)23)26-15(12)22-14(9)20/h1-5H,19H2,(H2,20,22)(H2,21,23) |
| InChIKey | SGAHORYOKKQHGU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 154.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [3,6-diamino-4-(1-benzofuran-5-yl)-5-cyanothieno[2,3-b]pyridin-2-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,6-diamino-4-(1-benzofuran-5-yl)-5-cyanothieno[2,3-b]pyridin-2-yl] carbamate?
The IUPAC name of [3,6-diamino-4-(1-benzofuran-5-yl)-5-cyanothieno[2,3-b]pyridin-2-yl] carbamate (CID 68731683) is [3,6-diamino-4-(1-benzofuran-5-yl)-5-cyanothieno[2,3-b]pyridin-2-yl] carbamate.
What is the SMILES notation for [3,6-diamino-4-(1-benzofuran-5-yl)-5-cyanothieno[2,3-b]pyridin-2-yl] carbamate?
The canonical SMILES for [3,6-diamino-4-(1-benzofuran-5-yl)-5-cyanothieno[2,3-b]pyridin-2-yl] carbamate is N#Cc1c(N)nc2sc(OC(N)=O)c(N)c2c1-c1ccc2occc2c1.
What is the InChIKey of [3,6-diamino-4-(1-benzofuran-5-yl)-5-cyanothieno[2,3-b]pyridin-2-yl] carbamate?
The InChIKey is SGAHORYOKKQHGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11N5O3S/c18-6-9-11(8-1-2-10-7(5-8)3-4-24-10)12-13(19)16(25-17(21)23)26-15(12)22-14(9)20/h1-5H,19H2,(H2,20,22)(H2,21,23).
What are the key properties of [3,6-diamino-4-(1-benzofuran-5-yl)-5-cyanothieno[2,3-b]pyridin-2-yl] carbamate?
[3,6-diamino-4-(1-benzofuran-5-yl)-5-cyanothieno[2,3-b]pyridin-2-yl] carbamate has a molecular weight of 365.37 g/mol, XLogP of 3.20, 2 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3,6-diamino-4-(1-benzofuran-5-yl)-5-cyanothieno[2,3-b]pyridin-2-yl] carbamate is sourced from PubChem (CID 68731683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).