C16H19ClF3IO3 — CID 68731969
2-[3-chloro-4-iodo-5-(2,2,2-trifluoroethoxy)phenyl]-4-methylheptanoic acid (PubChem CID 68731969) has the molecular formula C16H19ClF3IO3 and a molecular weight of 478.68 g/mol. Its IUPAC name is 2-[3-chloro-4-iodo-5-(2,2,2-trifluoroethoxy)phenyl]-4-methylheptanoic acid.
| Compound Name | 2-[3-chloro-4-iodo-5-(2,2,2-trifluoroethoxy)phenyl]-4-methylheptanoic acid |
|---|---|
| PubChem CID | 68731969 |
| Molecular Formula | C16H19ClF3IO3 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.00 |
| IUPAC Name | 2-[3-chloro-4-iodo-5-(2,2,2-trifluoroethoxy)phenyl]-4-methylheptanoic acid |
| SMILES | CCCC(C)CC(C(=O)O)c1cc(Cl)c(I)c(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C16H19ClF3IO3/c1-3-4-9(2)5-11(15(22)23)10-6-12(17)14(21)13(7-10)24-8-16(18,19)20/h6-7,9,11H,3-5,8H2,1-2H3,(H,22,23) |
| InChIKey | SYFLETGNRPTYQA-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|