About N-(3-tert-butyl-1,2-oxazol-5-yl)-2-methyl-2-morpholin-4-ylsulfonylpropanamide
N-(3-tert-butyl-1,2-oxazol-5-yl)-2-methyl-2-morpholin-4-ylsulfonylpropanamide (PubChem CID 68732117) has the molecular formula C15H25N3O5S
and a molecular weight of 359.45 g/mol. Its IUPAC name is N-(3-tert-butyl-1,2-oxazol-5-yl)-2-methyl-2-morpholin-4-ylsulfonylpropanamide.
Molecular Properties
| Compound Name | N-(3-tert-butyl-1,2-oxazol-5-yl)-2-methyl-2-morpholin-4-ylsulfonylpropanamide |
| PubChem CID | 68732117 |
| Molecular Formula | C15H25N3O5S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-(3-tert-butyl-1,2-oxazol-5-yl)-2-methyl-2-morpholin-4-ylsulfonylpropanamide |
| SMILES | CC(C)(C)c1cc(NC(=O)C(C)(C)S(=O)(=O)N2CCOCC2)on1 |
| InChI | InChI=1S/C15H25N3O5S/c1-14(2,3)11-10-12(23-17-11)16-13(19)15(4,5)24(20,21)18-6-8-22-9-7-18/h10H,6-9H2,1-5H3,(H,16,19) |
| InChIKey | OIBDBOWITPGFSS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(3-tert-butyl-1,2-oxazol-5-yl)-2-methyl-2-morpholin-4-ylsulfonylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-tert-butyl-1,2-oxazol-5-yl)-2-methyl-2-morpholin-4-ylsulfonylpropanamide?
The IUPAC name of N-(3-tert-butyl-1,2-oxazol-5-yl)-2-methyl-2-morpholin-4-ylsulfonylpropanamide (CID 68732117) is N-(3-tert-butyl-1,2-oxazol-5-yl)-2-methyl-2-morpholin-4-ylsulfonylpropanamide.
What is the SMILES notation for N-(3-tert-butyl-1,2-oxazol-5-yl)-2-methyl-2-morpholin-4-ylsulfonylpropanamide?
The canonical SMILES for N-(3-tert-butyl-1,2-oxazol-5-yl)-2-methyl-2-morpholin-4-ylsulfonylpropanamide is CC(C)(C)c1cc(NC(=O)C(C)(C)S(=O)(=O)N2CCOCC2)on1.
What is the InChIKey of N-(3-tert-butyl-1,2-oxazol-5-yl)-2-methyl-2-morpholin-4-ylsulfonylpropanamide?
The InChIKey is OIBDBOWITPGFSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O5S/c1-14(2,3)11-10-12(23-17-11)16-13(19)15(4,5)24(20,21)18-6-8-22-9-7-18/h10H,6-9H2,1-5H3,(H,16,19).
What are the key properties of N-(3-tert-butyl-1,2-oxazol-5-yl)-2-methyl-2-morpholin-4-ylsulfonylpropanamide?
N-(3-tert-butyl-1,2-oxazol-5-yl)-2-methyl-2-morpholin-4-ylsulfonylpropanamide has a molecular weight of 359.45 g/mol, XLogP of 1.35, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-tert-butyl-1,2-oxazol-5-yl)-2-methyl-2-morpholin-4-ylsulfonylpropanamide is sourced from PubChem (CID 68732117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).