About 6,7-dihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-one
6,7-dihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-one (PubChem CID 68732637) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is 6,7-dihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-one.
Molecular Properties
| Compound Name | 6,7-dihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-one |
| PubChem CID | 68732637 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 6,7-dihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-one |
| SMILES | CC12CC(=O)CC(C)(O1)C(O)C2O |
| InChI | InChI=1S/C9H14O4/c1-8-3-5(10)4-9(2,13-8)7(12)6(8)11/h6-7,11-12H,3-4H2,1-2H3 |
| InChIKey | KHCQMRLNERQHKR-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,7-dihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-one?
The IUPAC name of 6,7-dihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-one (CID 68732637) is 6,7-dihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-one.
What is the SMILES notation for 6,7-dihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-one?
The canonical SMILES for 6,7-dihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-one is CC12CC(=O)CC(C)(O1)C(O)C2O.
What is the InChIKey of 6,7-dihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-one?
The InChIKey is KHCQMRLNERQHKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4/c1-8-3-5(10)4-9(2,13-8)7(12)6(8)11/h6-7,11-12H,3-4H2,1-2H3.
What are the key properties of 6,7-dihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-one?
6,7-dihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-one has a molecular weight of 186.21 g/mol, XLogP of -0.38, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-one is sourced from PubChem (CID 68732637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).