About 2-hex-2-enyl-1,6-dioxaspiro[4.4]nonane
2-hex-2-enyl-1,6-dioxaspiro[4.4]nonane (PubChem CID 68733344) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-hex-2-enyl-1,6-dioxaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 2-hex-2-enyl-1,6-dioxaspiro[4.4]nonane |
| PubChem CID | 68733344 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 2-hex-2-enyl-1,6-dioxaspiro[4.4]nonane |
| SMILES | CCCC=CCC1CCC2(CCCO2)O1 |
| InChI | InChI=1S/C13H22O2/c1-2-3-4-5-7-12-8-10-13(15-12)9-6-11-14-13/h4-5,12H,2-3,6-11H2,1H3 |
| InChIKey | GVEMZRBTPWFDJX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-hex-2-enyl-1,6-dioxaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hex-2-enyl-1,6-dioxaspiro[4.4]nonane?
The IUPAC name of 2-hex-2-enyl-1,6-dioxaspiro[4.4]nonane (CID 68733344) is 2-hex-2-enyl-1,6-dioxaspiro[4.4]nonane.
What is the SMILES notation for 2-hex-2-enyl-1,6-dioxaspiro[4.4]nonane?
The canonical SMILES for 2-hex-2-enyl-1,6-dioxaspiro[4.4]nonane is CCCC=CCC1CCC2(CCCO2)O1.
What is the InChIKey of 2-hex-2-enyl-1,6-dioxaspiro[4.4]nonane?
The InChIKey is GVEMZRBTPWFDJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O2/c1-2-3-4-5-7-12-8-10-13(15-12)9-6-11-14-13/h4-5,12H,2-3,6-11H2,1H3.
What are the key properties of 2-hex-2-enyl-1,6-dioxaspiro[4.4]nonane?
2-hex-2-enyl-1,6-dioxaspiro[4.4]nonane has a molecular weight of 210.32 g/mol, XLogP of 3.42, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hex-2-enyl-1,6-dioxaspiro[4.4]nonane is sourced from PubChem (CID 68733344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).