C16H15FO4 — CID 68733460
(6R,7S)-6-(4-fluoro-3-hydroxyphenyl)-5,6,7,8-tetrahydronaphthalene-1,3,7-triol (PubChem CID 68733460) has the molecular formula C16H15FO4 and a molecular weight of 290.29 g/mol. Its IUPAC name is (6R,7S)-6-(4-fluoro-3-hydroxyphenyl)-5,6,7,8-tetrahydronaphthalene-1,3,7-triol.
| Compound Name | (6R,7S)-6-(4-fluoro-3-hydroxyphenyl)-5,6,7,8-tetrahydronaphthalene-1,3,7-triol |
|---|---|
| PubChem CID | 68733460 |
| Molecular Formula | C16H15FO4 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | (6R,7S)-6-(4-fluoro-3-hydroxyphenyl)-5,6,7,8-tetrahydronaphthalene-1,3,7-triol |
| SMILES | Oc1cc(O)c2c(c1)C[C@H](c1ccc(F)c(O)c1)[C@@H](O)C2 |
| InChI | InChI=1S/C16H15FO4/c17-13-2-1-8(5-16(13)21)11-4-9-3-10(18)6-14(19)12(9)7-15(11)20/h1-3,5-6,11,15,18-21H,4,7H2/t11-,15+/m1/s1 |
| InChIKey | LNUKQDCIHHDVGM-ABAIWWIYSA-N |
| XLogP | 2.19 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |