C12H12F5N5O2 — CID 68733783
5-methyl-4-(2,2,4,4,4-pentafluoro-3-methoxybutoxy)-6-(1,2,4-triazol-1-yl)pyrimidine (PubChem CID 68733783) has the molecular formula C12H12F5N5O2 and a molecular weight of 353.25 g/mol. Its IUPAC name is 5-methyl-4-(2,2,4,4,4-pentafluoro-3-methoxybutoxy)-6-(1,2,4-triazol-1-yl)pyrimidine.
| Compound Name | 5-methyl-4-(2,2,4,4,4-pentafluoro-3-methoxybutoxy)-6-(1,2,4-triazol-1-yl)pyrimidine |
|---|---|
| PubChem CID | 68733783 |
| Molecular Formula | C12H12F5N5O2 |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 5-methyl-4-(2,2,4,4,4-pentafluoro-3-methoxybutoxy)-6-(1,2,4-triazol-1-yl)pyrimidine |
| SMILES | COC(C(F)(F)F)C(F)(F)COc1ncnc(-n2cncn2)c1C |
| InChI | InChI=1S/C12H12F5N5O2/c1-7-8(22-6-18-4-21-22)19-5-20-9(7)24-3-11(13,14)10(23-2)12(15,16)17/h4-6,10H,3H2,1-2H3 |
| InChIKey | JKCIAIRVXZYCGE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |