C45H32N6O11 — CID 68734092
[(2R,3R,4R,5S)-5-(6-amino-2-nitropurin-9-yl)-3,4,5-tribenzoyl-4-benzoyloxy-2-(hydroxymethyl)oxolan-3-yl] benzoate (PubChem CID 68734092) has the molecular formula C45H32N6O11 and a molecular weight of 832.78 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-5-(6-amino-2-nitropurin-9-yl)-3,4,5-tribenzoyl-4-benzoyloxy-2-(hydroxymethyl)oxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,4R,5S)-5-(6-amino-2-nitropurin-9-yl)-3,4,5-tribenzoyl-4-benzoyloxy-2-(hydroxymethyl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 68734092 |
| Molecular Formula | C45H32N6O11 |
| Molecular Weight | 832.78 g/mol |
| Exact Mass | 832.21 |
| IUPAC Name | [(2R,3R,4R,5S)-5-(6-amino-2-nitropurin-9-yl)-3,4,5-tribenzoyl-4-benzoyloxy-2-(hydroxymethyl)oxolan-3-yl] benzoate |
| SMILES | Nc1nc([N+](=O)[O-])nc2c1ncn2[C@]1(C(=O)c2ccccc2)O[C@H](CO)[C@](OC(=O)c2ccccc2)(C(=O)c2ccccc2)[C@]1(OC(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C45H32N6O11/c46-38-34-39(49-42(48-38)51(58)59)50(27-47-34)45(37(55)30-20-10-3-11-21-30)44(36(54)29-18-8-2-9-19-29,62-41(57)32-24-14-5-15-25-32)43(33(26-52)60-45,35(53)28-16-6-1-7-17-28)61-40(56)31-22-12-4-13-23-31/h1-25,27,33,52H,26H2,(H2,46,48,49)/t33-,43+,44-,45-/m1/s1 |
| InChIKey | CQKMTFLUEMUAKY-AHYYQIPQSA-N |
| XLogP | 5.20 |
| TPSA | 246.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.78 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|