About N-(5-tert-butyl-1,2-oxazol-3-yl)-2-(3-fluoropyrrolidin-1-yl)sulfonyl-2-methylpropanamide
N-(5-tert-butyl-1,2-oxazol-3-yl)-2-(3-fluoropyrrolidin-1-yl)sulfonyl-2-methylpropanamide (PubChem CID 68734168) has the molecular formula C15H24FN3O4S
and a molecular weight of 361.44 g/mol. Its IUPAC name is N-(5-tert-butyl-1,2-oxazol-3-yl)-2-(3-fluoropyrrolidin-1-yl)sulfonyl-2-methylpropanamide.
Molecular Properties
| Compound Name | N-(5-tert-butyl-1,2-oxazol-3-yl)-2-(3-fluoropyrrolidin-1-yl)sulfonyl-2-methylpropanamide |
| PubChem CID | 68734168 |
| Molecular Formula | C15H24FN3O4S |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-(5-tert-butyl-1,2-oxazol-3-yl)-2-(3-fluoropyrrolidin-1-yl)sulfonyl-2-methylpropanamide |
| SMILES | CC(C)(C)c1cc(NC(=O)C(C)(C)S(=O)(=O)N2CCC(F)C2)no1 |
| InChI | InChI=1S/C15H24FN3O4S/c1-14(2,3)11-8-12(18-23-11)17-13(20)15(4,5)24(21,22)19-7-6-10(16)9-19/h8,10H,6-7,9H2,1-5H3,(H,17,18,20) |
| InChIKey | SEYCXFRWNZNHAI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(5-tert-butyl-1,2-oxazol-3-yl)-2-(3-fluoropyrrolidin-1-yl)sulfonyl-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-tert-butyl-1,2-oxazol-3-yl)-2-(3-fluoropyrrolidin-1-yl)sulfonyl-2-methylpropanamide?
The IUPAC name of N-(5-tert-butyl-1,2-oxazol-3-yl)-2-(3-fluoropyrrolidin-1-yl)sulfonyl-2-methylpropanamide (CID 68734168) is N-(5-tert-butyl-1,2-oxazol-3-yl)-2-(3-fluoropyrrolidin-1-yl)sulfonyl-2-methylpropanamide.
What is the SMILES notation for N-(5-tert-butyl-1,2-oxazol-3-yl)-2-(3-fluoropyrrolidin-1-yl)sulfonyl-2-methylpropanamide?
The canonical SMILES for N-(5-tert-butyl-1,2-oxazol-3-yl)-2-(3-fluoropyrrolidin-1-yl)sulfonyl-2-methylpropanamide is CC(C)(C)c1cc(NC(=O)C(C)(C)S(=O)(=O)N2CCC(F)C2)no1.
What is the InChIKey of N-(5-tert-butyl-1,2-oxazol-3-yl)-2-(3-fluoropyrrolidin-1-yl)sulfonyl-2-methylpropanamide?
The InChIKey is SEYCXFRWNZNHAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24FN3O4S/c1-14(2,3)11-8-12(18-23-11)17-13(20)15(4,5)24(21,22)19-7-6-10(16)9-19/h8,10H,6-7,9H2,1-5H3,(H,17,18,20).
What are the key properties of N-(5-tert-butyl-1,2-oxazol-3-yl)-2-(3-fluoropyrrolidin-1-yl)sulfonyl-2-methylpropanamide?
N-(5-tert-butyl-1,2-oxazol-3-yl)-2-(3-fluoropyrrolidin-1-yl)sulfonyl-2-methylpropanamide has a molecular weight of 361.44 g/mol, XLogP of 2.06, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-tert-butyl-1,2-oxazol-3-yl)-2-(3-fluoropyrrolidin-1-yl)sulfonyl-2-methylpropanamide is sourced from PubChem (CID 68734168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).