About 9H-fluorene;9H-fluoren-9-ol
9H-fluorene;9H-fluoren-9-ol (PubChem CID 68734201) has the molecular formula C26H20O
and a molecular weight of 348.45 g/mol. Its IUPAC name is 9H-fluorene;9H-fluoren-9-ol.
Molecular Properties
| Compound Name | 9H-fluorene;9H-fluoren-9-ol |
| PubChem CID | 68734201 |
| Molecular Formula | C26H20O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 9H-fluorene;9H-fluoren-9-ol |
| SMILES | OC1c2ccccc2-c2ccccc21.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10O.C13H10/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-8,13-14H;1-8H,9H2 |
| InChIKey | VXRUMNKFAUTFPY-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9H-fluorene;9H-fluoren-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluorene;9H-fluoren-9-ol?
The IUPAC name of 9H-fluorene;9H-fluoren-9-ol (CID 68734201) is 9H-fluorene;9H-fluoren-9-ol.
What is the SMILES notation for 9H-fluorene;9H-fluoren-9-ol?
The canonical SMILES for 9H-fluorene;9H-fluoren-9-ol is OC1c2ccccc2-c2ccccc21.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 9H-fluorene;9H-fluoren-9-ol?
The InChIKey is VXRUMNKFAUTFPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C13H10/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-8,13-14H;1-8H,9H2.
What are the key properties of 9H-fluorene;9H-fluoren-9-ol?
9H-fluorene;9H-fluoren-9-ol has a molecular weight of 348.45 g/mol, XLogP of 6.01, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluorene;9H-fluoren-9-ol is sourced from PubChem (CID 68734201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).