C21H20O8 — CID 68734254
5-hydroxy-2-phenyl-3-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one (PubChem CID 68734254) has the molecular formula C21H20O8 and a molecular weight of 400.38 g/mol. Its IUPAC name is 5-hydroxy-2-phenyl-3-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one.
| Compound Name | 5-hydroxy-2-phenyl-3-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one |
|---|---|
| PubChem CID | 68734254 |
| Molecular Formula | C21H20O8 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 5-hydroxy-2-phenyl-3-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one |
| SMILES | C[C@H]1OC(Oc2c(-c3ccccc3)oc3cccc(O)c3c2=O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H20O8/c1-10-15(23)17(25)18(26)21(27-10)29-20-16(24)14-12(22)8-5-9-13(14)28-19(20)11-6-3-2-4-7-11/h2-10,15,17-18,21-23,25-26H,1H3/t10-,15+,17+,18-,21?/m1/s1 |
| InChIKey | NIXIHCNHOZOWPR-YBYAYQEISA-N |
| XLogP | 1.37 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |