About N-[3-(6-methoxy-1,5-naphthyridin-4-yl)propyl]acetamide
N-[3-(6-methoxy-1,5-naphthyridin-4-yl)propyl]acetamide (PubChem CID 68734493) has the molecular formula C14H17N3O2
and a molecular weight of 259.31 g/mol. Its IUPAC name is N-[3-(6-methoxy-1,5-naphthyridin-4-yl)propyl]acetamide.
Molecular Properties
| Compound Name | N-[3-(6-methoxy-1,5-naphthyridin-4-yl)propyl]acetamide |
| PubChem CID | 68734493 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | N-[3-(6-methoxy-1,5-naphthyridin-4-yl)propyl]acetamide |
| SMILES | COc1ccc2nccc(CCCNC(C)=O)c2n1 |
| InChI | InChI=1S/C14H17N3O2/c1-10(18)15-8-3-4-11-7-9-16-12-5-6-13(19-2)17-14(11)12/h5-7,9H,3-4,8H2,1-2H3,(H,15,18) |
| InChIKey | KVGGDUMJMYATDP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(6-methoxy-1,5-naphthyridin-4-yl)propyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(6-methoxy-1,5-naphthyridin-4-yl)propyl]acetamide?
The IUPAC name of N-[3-(6-methoxy-1,5-naphthyridin-4-yl)propyl]acetamide (CID 68734493) is N-[3-(6-methoxy-1,5-naphthyridin-4-yl)propyl]acetamide.
What is the SMILES notation for N-[3-(6-methoxy-1,5-naphthyridin-4-yl)propyl]acetamide?
The canonical SMILES for N-[3-(6-methoxy-1,5-naphthyridin-4-yl)propyl]acetamide is COc1ccc2nccc(CCCNC(C)=O)c2n1.
What is the InChIKey of N-[3-(6-methoxy-1,5-naphthyridin-4-yl)propyl]acetamide?
The InChIKey is KVGGDUMJMYATDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O2/c1-10(18)15-8-3-4-11-7-9-16-12-5-6-13(19-2)17-14(11)12/h5-7,9H,3-4,8H2,1-2H3,(H,15,18).
What are the key properties of N-[3-(6-methoxy-1,5-naphthyridin-4-yl)propyl]acetamide?
N-[3-(6-methoxy-1,5-naphthyridin-4-yl)propyl]acetamide has a molecular weight of 259.31 g/mol, XLogP of 1.71, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(6-methoxy-1,5-naphthyridin-4-yl)propyl]acetamide is sourced from PubChem (CID 68734493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).