About [3-(1-methylcyclopentyl)-1,2-oxazol-5-yl]urea
[3-(1-methylcyclopentyl)-1,2-oxazol-5-yl]urea (PubChem CID 68734787) has the molecular formula C10H15N3O2
and a molecular weight of 209.25 g/mol. Its IUPAC name is [3-(1-methylcyclopentyl)-1,2-oxazol-5-yl]urea.
Molecular Properties
| Compound Name | [3-(1-methylcyclopentyl)-1,2-oxazol-5-yl]urea |
| PubChem CID | 68734787 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | [3-(1-methylcyclopentyl)-1,2-oxazol-5-yl]urea |
| SMILES | CC1(c2cc(NC(N)=O)on2)CCCC1 |
| InChI | InChI=1S/C10H15N3O2/c1-10(4-2-3-5-10)7-6-8(15-13-7)12-9(11)14/h6H,2-5H2,1H3,(H3,11,12,14) |
| InChIKey | VRBHKXSCTFIUPL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(1-methylcyclopentyl)-1,2-oxazol-5-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1-methylcyclopentyl)-1,2-oxazol-5-yl]urea?
The IUPAC name of [3-(1-methylcyclopentyl)-1,2-oxazol-5-yl]urea (CID 68734787) is [3-(1-methylcyclopentyl)-1,2-oxazol-5-yl]urea.
What is the SMILES notation for [3-(1-methylcyclopentyl)-1,2-oxazol-5-yl]urea?
The canonical SMILES for [3-(1-methylcyclopentyl)-1,2-oxazol-5-yl]urea is CC1(c2cc(NC(N)=O)on2)CCCC1.
What is the InChIKey of [3-(1-methylcyclopentyl)-1,2-oxazol-5-yl]urea?
The InChIKey is VRBHKXSCTFIUPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2/c1-10(4-2-3-5-10)7-6-8(15-13-7)12-9(11)14/h6H,2-5H2,1H3,(H3,11,12,14).
What are the key properties of [3-(1-methylcyclopentyl)-1,2-oxazol-5-yl]urea?
[3-(1-methylcyclopentyl)-1,2-oxazol-5-yl]urea has a molecular weight of 209.25 g/mol, XLogP of 2.00, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1-methylcyclopentyl)-1,2-oxazol-5-yl]urea is sourced from PubChem (CID 68734787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).