C16H8BrF5N4O2 — CID 6873479
5-[(4-bromopyrazol-1-yl)methyl]-N-[(E)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]furan-2-carboxamide (PubChem CID 6873479) has the molecular formula C16H8BrF5N4O2 and a molecular weight of 463.16 g/mol. Its IUPAC name is 5-[(4-bromopyrazol-1-yl)methyl]-N-[(E)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[(4-bromopyrazol-1-yl)methyl]-N-[(E)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 6873479 |
| Molecular Formula | C16H8BrF5N4O2 |
| Molecular Weight | 463.16 g/mol |
| Exact Mass | 461.98 |
| IUPAC Name | 5-[(4-bromopyrazol-1-yl)methyl]-N-[(E)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]furan-2-carboxamide |
| SMILES | O=C(N/N=C/c1c(F)c(F)c(F)c(F)c1F)c1ccc(Cn2cc(Br)cn2)o1 |
| InChI | InChI=1S/C16H8BrF5N4O2/c17-7-3-24-26(5-7)6-8-1-2-10(28-8)16(27)25-23-4-9-11(18)13(20)15(22)14(21)12(9)19/h1-5H,6H2,(H,25,27)/b23-4+ |
| InChIKey | NTZQMVXQJKADOR-QFSHWATDSA-N |
| XLogP | 3.75 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.16 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|