C26H24N4O2 — CID 6873482
2-(4-butoxyphenyl)-N-[(E)-pyridin-4-ylmethylideneamino]quinoline-4-carboxamide (PubChem CID 6873482) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-N-[(E)-pyridin-4-ylmethylideneamino]quinoline-4-carboxamide.
| Compound Name | 2-(4-butoxyphenyl)-N-[(E)-pyridin-4-ylmethylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 6873482 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 2-(4-butoxyphenyl)-N-[(E)-pyridin-4-ylmethylideneamino]quinoline-4-carboxamide |
| SMILES | CCCCOc1ccc(-c2cc(C(=O)N/N=C/c3ccncc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C26H24N4O2/c1-2-3-16-32-21-10-8-20(9-11-21)25-17-23(22-6-4-5-7-24(22)29-25)26(31)30-28-18-19-12-14-27-15-13-19/h4-15,17-18H,2-3,16H2,1H3,(H,30,31)/b28-18+ |
| InChIKey | LNDXQOJZYPLBBZ-MTDXEUNCSA-N |
| XLogP | 5.24 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|