About (5-aminoindol-1-yl) 2-phenylacetate
(5-aminoindol-1-yl) 2-phenylacetate (PubChem CID 68735166) has the molecular formula C16H14N2O2
and a molecular weight of 266.30 g/mol. Its IUPAC name is (5-aminoindol-1-yl) 2-phenylacetate.
Molecular Properties
| Compound Name | (5-aminoindol-1-yl) 2-phenylacetate |
| PubChem CID | 68735166 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | (5-aminoindol-1-yl) 2-phenylacetate |
| SMILES | Nc1ccc2c(ccn2OC(=O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C16H14N2O2/c17-14-6-7-15-13(11-14)8-9-18(15)20-16(19)10-12-4-2-1-3-5-12/h1-9,11H,10,17H2 |
| InChIKey | IFRQKPYSZVFTSF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (5-aminoindol-1-yl) 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-aminoindol-1-yl) 2-phenylacetate?
The IUPAC name of (5-aminoindol-1-yl) 2-phenylacetate (CID 68735166) is (5-aminoindol-1-yl) 2-phenylacetate.
What is the SMILES notation for (5-aminoindol-1-yl) 2-phenylacetate?
The canonical SMILES for (5-aminoindol-1-yl) 2-phenylacetate is Nc1ccc2c(ccn2OC(=O)Cc2ccccc2)c1.
What is the InChIKey of (5-aminoindol-1-yl) 2-phenylacetate?
The InChIKey is IFRQKPYSZVFTSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O2/c17-14-6-7-15-13(11-14)8-9-18(15)20-16(19)10-12-4-2-1-3-5-12/h1-9,11H,10,17H2.
What are the key properties of (5-aminoindol-1-yl) 2-phenylacetate?
(5-aminoindol-1-yl) 2-phenylacetate has a molecular weight of 266.30 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-aminoindol-1-yl) 2-phenylacetate is sourced from PubChem (CID 68735166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).