C24H25ClO3 — CID 68735293
(1R,5S)-3-[4-(4-chlorophenyl)-2,6-diethylphenyl]-1-methyl-8-oxabicyclo[3.2.1]octane-2,4-dione (PubChem CID 68735293) has the molecular formula C24H25ClO3 and a molecular weight of 396.91 g/mol. Its IUPAC name is (1R,5S)-3-[4-(4-chlorophenyl)-2,6-diethylphenyl]-1-methyl-8-oxabicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1R,5S)-3-[4-(4-chlorophenyl)-2,6-diethylphenyl]-1-methyl-8-oxabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 68735293 |
| Molecular Formula | C24H25ClO3 |
| Molecular Weight | 396.91 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (1R,5S)-3-[4-(4-chlorophenyl)-2,6-diethylphenyl]-1-methyl-8-oxabicyclo[3.2.1]octane-2,4-dione |
| SMILES | CCc1cc(-c2ccc(Cl)cc2)cc(CC)c1C1C(=O)[C@@H]2CC[C@@](C)(O2)C1=O |
| InChI | InChI=1S/C24H25ClO3/c1-4-14-12-17(16-6-8-18(25)9-7-16)13-15(5-2)20(14)21-22(26)19-10-11-24(3,28-19)23(21)27/h6-9,12-13,19,21H,4-5,10-11H2,1-3H3/t19-,21?,24+/m0/s1 |
| InChIKey | RZSZLFUTQNOGKD-LDEFDFMYSA-N |
| XLogP | 5.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.91 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|