C23H15ClF2N4O3 — CID 68735331
N-[4-[(2-amino-3-chloro-4-pyridinyl)oxy]-3-fluorophenyl]-3-(4-fluorophenyl)-4-oxo-3H-pyridine-5-carboxamide (PubChem CID 68735331) has the molecular formula C23H15ClF2N4O3 and a molecular weight of 468.85 g/mol. Its IUPAC name is N-[4-[(2-amino-3-chloro-4-pyridinyl)oxy]-3-fluorophenyl]-3-(4-fluorophenyl)-4-oxo-3H-pyridine-5-carboxamide.
| Compound Name | N-[4-[(2-amino-3-chloro-4-pyridinyl)oxy]-3-fluorophenyl]-3-(4-fluorophenyl)-4-oxo-3H-pyridine-5-carboxamide |
|---|---|
| PubChem CID | 68735331 |
| Molecular Formula | C23H15ClF2N4O3 |
| Molecular Weight | 468.85 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | N-[4-[(2-amino-3-chloro-4-pyridinyl)oxy]-3-fluorophenyl]-3-(4-fluorophenyl)-4-oxo-3H-pyridine-5-carboxamide |
| SMILES | Nc1nccc(Oc2ccc(NC(=O)C3=CN=CC(c4ccc(F)cc4)C3=O)cc2F)c1Cl |
| InChI | InChI=1S/C23H15ClF2N4O3/c24-20-19(7-8-29-22(20)27)33-18-6-5-14(9-17(18)26)30-23(32)16-11-28-10-15(21(16)31)12-1-3-13(25)4-2-12/h1-11,15H,(H2,27,29)(H,30,32) |
| InChIKey | UTLWSFCHXVXZCI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.85 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|