C32H50N6O6S — CID 68735742
(2S)-2-[(diaminomethylideneamino)-[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]-3-phenylpropanoic acid;ethyl piperazine-1-carboxylate (PubChem CID 68735742) has the molecular formula C32H50N6O6S and a molecular weight of 646.86 g/mol. Its IUPAC name is (2S)-2-[(diaminomethylideneamino)-[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]-3-phenylpropanoic acid;ethyl piperazine-1-carboxylate.
| Compound Name | (2S)-2-[(diaminomethylideneamino)-[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]-3-phenylpropanoic acid;ethyl piperazine-1-carboxylate |
|---|---|
| PubChem CID | 68735742 |
| Molecular Formula | C32H50N6O6S |
| Molecular Weight | 646.86 g/mol |
| Exact Mass | 646.35 |
| IUPAC Name | (2S)-2-[(diaminomethylideneamino)-[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]-3-phenylpropanoic acid;ethyl piperazine-1-carboxylate |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)N(N=C(N)N)[C@@H](Cc2ccccc2)C(=O)O)c(C(C)C)c1.CCOC(=O)N1CCNCC1 |
| InChI | InChI=1S/C25H36N4O4S.C7H14N2O2/c1-15(2)19-13-20(16(3)4)23(21(14-19)17(5)6)34(32,33)29(28-25(26)27)22(24(30)31)12-18-10-8-7-9-11-18;1-2-11-7(10)9-5-3-8-4-6-9/h7-11,13-17,22H,12H2,1-6H3,(H,30,31)(H4,26,27,28);8H,2-6H2,1H3/t22-;/m0./s1 |
| InChIKey | YWMLEEXPIWBGPQ-FTBISJDPSA-N |
| XLogP | 3.98 |
| TPSA | 180.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.86 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|