About methyl 2-(4-fluorophenyl)-7-methyl-7,8-dihydrofuro[3,2-e][1]benzofuran-1-carboxylate
methyl 2-(4-fluorophenyl)-7-methyl-7,8-dihydrofuro[3,2-e][1]benzofuran-1-carboxylate (PubChem CID 68735912) has the molecular formula C19H15FO4
and a molecular weight of 326.32 g/mol. Its IUPAC name is methyl 2-(4-fluorophenyl)-7-methyl-7,8-dihydrofuro[3,2-e][1]benzofuran-1-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(4-fluorophenyl)-7-methyl-7,8-dihydrofuro[3,2-e][1]benzofuran-1-carboxylate |
| PubChem CID | 68735912 |
| Molecular Formula | C19H15FO4 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | methyl 2-(4-fluorophenyl)-7-methyl-7,8-dihydrofuro[3,2-e][1]benzofuran-1-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(F)cc2)oc2ccc3c(c12)CC(C)O3 |
| InChI | InChI=1S/C19H15FO4/c1-10-9-13-14(23-10)7-8-15-16(13)17(19(21)22-2)18(24-15)11-3-5-12(20)6-4-11/h3-8,10H,9H2,1-2H3 |
| InChIKey | IKGXPOBTQUEEIM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(4-fluorophenyl)-7-methyl-7,8-dihydrofuro[3,2-e][1]benzofuran-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(4-fluorophenyl)-7-methyl-7,8-dihydrofuro[3,2-e][1]benzofuran-1-carboxylate?
The IUPAC name of methyl 2-(4-fluorophenyl)-7-methyl-7,8-dihydrofuro[3,2-e][1]benzofuran-1-carboxylate (CID 68735912) is methyl 2-(4-fluorophenyl)-7-methyl-7,8-dihydrofuro[3,2-e][1]benzofuran-1-carboxylate.
What is the SMILES notation for methyl 2-(4-fluorophenyl)-7-methyl-7,8-dihydrofuro[3,2-e][1]benzofuran-1-carboxylate?
The canonical SMILES for methyl 2-(4-fluorophenyl)-7-methyl-7,8-dihydrofuro[3,2-e][1]benzofuran-1-carboxylate is COC(=O)c1c(-c2ccc(F)cc2)oc2ccc3c(c12)CC(C)O3.
What is the InChIKey of methyl 2-(4-fluorophenyl)-7-methyl-7,8-dihydrofuro[3,2-e][1]benzofuran-1-carboxylate?
The InChIKey is IKGXPOBTQUEEIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15FO4/c1-10-9-13-14(23-10)7-8-15-16(13)17(19(21)22-2)18(24-15)11-3-5-12(20)6-4-11/h3-8,10H,9H2,1-2H3.
What are the key properties of methyl 2-(4-fluorophenyl)-7-methyl-7,8-dihydrofuro[3,2-e][1]benzofuran-1-carboxylate?
methyl 2-(4-fluorophenyl)-7-methyl-7,8-dihydrofuro[3,2-e][1]benzofuran-1-carboxylate has a molecular weight of 326.32 g/mol, XLogP of 4.35, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-fluorophenyl)-7-methyl-7,8-dihydrofuro[3,2-e][1]benzofuran-1-carboxylate is sourced from PubChem (CID 68735912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).