C16H17BrN2O6 — CID 68735935
3-O-tert-butyl 2-O-methyl 5-(bromomethyl)-7-nitro-1H-indole-2,3-dicarboxylate (PubChem CID 68735935) has the molecular formula C16H17BrN2O6 and a molecular weight of 413.22 g/mol. Its IUPAC name is 3-O-tert-butyl 2-O-methyl 5-(bromomethyl)-7-nitro-1H-indole-2,3-dicarboxylate.
| Compound Name | 3-O-tert-butyl 2-O-methyl 5-(bromomethyl)-7-nitro-1H-indole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 68735935 |
| Molecular Formula | C16H17BrN2O6 |
| Molecular Weight | 413.22 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 3-O-tert-butyl 2-O-methyl 5-(bromomethyl)-7-nitro-1H-indole-2,3-dicarboxylate |
| SMILES | COC(=O)c1[nH]c2c([N+](=O)[O-])cc(CBr)cc2c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H17BrN2O6/c1-16(2,3)25-14(20)11-9-5-8(7-17)6-10(19(22)23)12(9)18-13(11)15(21)24-4/h5-6,18H,7H2,1-4H3 |
| InChIKey | MFQOHUFUOHFBFZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.22 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|