C14H19N3O — CID 68737386
2-[3-(oxan-2-yl)-2H-indazol-5-yl]ethanamine (PubChem CID 68737386) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 2-[3-(oxan-2-yl)-2H-indazol-5-yl]ethanamine.
| Compound Name | 2-[3-(oxan-2-yl)-2H-indazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 68737386 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 2-[3-(oxan-2-yl)-2H-indazol-5-yl]ethanamine |
| SMILES | NCCc1ccc2n[nH]c(C3CCCCO3)c2c1 |
| InChI | InChI=1S/C14H19N3O/c15-7-6-10-4-5-12-11(9-10)14(17-16-12)13-3-1-2-8-18-13/h4-5,9,13H,1-3,6-8,15H2,(H,16,17) |
| InChIKey | GAKITEQDGOOKQF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |