About N-[2-(4-chlorophenyl)phenyl]-N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide
N-[2-(4-chlorophenyl)phenyl]-N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide (PubChem CID 68737415) has the molecular formula C18H13ClF2N2OS
and a molecular weight of 378.83 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)phenyl]-N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[2-(4-chlorophenyl)phenyl]-N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 68737415 |
| Molecular Formula | C18H13ClF2N2OS |
| Molecular Weight | 378.83 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | N-[2-(4-chlorophenyl)phenyl]-N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncc(C(=O)N(c2ccccc2-c2ccc(Cl)cc2)C(F)F)s1 |
| InChI | InChI=1S/C18H13ClF2N2OS/c1-11-22-10-16(25-11)17(24)23(18(20)21)15-5-3-2-4-14(15)12-6-8-13(19)9-7-12/h2-10,18H,1H3 |
| InChIKey | RYQGZKXJEGFLFB-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.83 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(4-chlorophenyl)phenyl]-N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-chlorophenyl)phenyl]-N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide?
The IUPAC name of N-[2-(4-chlorophenyl)phenyl]-N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide (CID 68737415) is N-[2-(4-chlorophenyl)phenyl]-N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-[2-(4-chlorophenyl)phenyl]-N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-[2-(4-chlorophenyl)phenyl]-N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide is Cc1ncc(C(=O)N(c2ccccc2-c2ccc(Cl)cc2)C(F)F)s1.
What is the InChIKey of N-[2-(4-chlorophenyl)phenyl]-N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide?
The InChIKey is RYQGZKXJEGFLFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13ClF2N2OS/c1-11-22-10-16(25-11)17(24)23(18(20)21)15-5-3-2-4-14(15)12-6-8-13(19)9-7-12/h2-10,18H,1H3.
What are the key properties of N-[2-(4-chlorophenyl)phenyl]-N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide?
N-[2-(4-chlorophenyl)phenyl]-N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide has a molecular weight of 378.83 g/mol, XLogP of 5.64, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-chlorophenyl)phenyl]-N-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 68737415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).