About pyridin-2-yl N-[[2-hydroxy-3-phenyl-5-(trifluoromethyl)phenyl]methyl]-N-methylcarbamate
pyridin-2-yl N-[[2-hydroxy-3-phenyl-5-(trifluoromethyl)phenyl]methyl]-N-methylcarbamate (PubChem CID 68737859) has the molecular formula C21H17F3N2O3
and a molecular weight of 402.37 g/mol. Its IUPAC name is pyridin-2-yl N-[[2-hydroxy-3-phenyl-5-(trifluoromethyl)phenyl]methyl]-N-methylcarbamate.
Molecular Properties
| Compound Name | pyridin-2-yl N-[[2-hydroxy-3-phenyl-5-(trifluoromethyl)phenyl]methyl]-N-methylcarbamate |
| PubChem CID | 68737859 |
| Molecular Formula | C21H17F3N2O3 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | pyridin-2-yl N-[[2-hydroxy-3-phenyl-5-(trifluoromethyl)phenyl]methyl]-N-methylcarbamate |
| SMILES | CN(Cc1cc(C(F)(F)F)cc(-c2ccccc2)c1O)C(=O)Oc1ccccn1 |
| InChI | InChI=1S/C21H17F3N2O3/c1-26(20(28)29-18-9-5-6-10-25-18)13-15-11-16(21(22,23)24)12-17(19(15)27)14-7-3-2-4-8-14/h2-12,27H,13H2,1H3 |
| InChIKey | MCVDFTPBQOMKFH-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze pyridin-2-yl N-[[2-hydroxy-3-phenyl-5-(trifluoromethyl)phenyl]methyl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-yl N-[[2-hydroxy-3-phenyl-5-(trifluoromethyl)phenyl]methyl]-N-methylcarbamate?
The IUPAC name of pyridin-2-yl N-[[2-hydroxy-3-phenyl-5-(trifluoromethyl)phenyl]methyl]-N-methylcarbamate (CID 68737859) is pyridin-2-yl N-[[2-hydroxy-3-phenyl-5-(trifluoromethyl)phenyl]methyl]-N-methylcarbamate.
What is the SMILES notation for pyridin-2-yl N-[[2-hydroxy-3-phenyl-5-(trifluoromethyl)phenyl]methyl]-N-methylcarbamate?
The canonical SMILES for pyridin-2-yl N-[[2-hydroxy-3-phenyl-5-(trifluoromethyl)phenyl]methyl]-N-methylcarbamate is CN(Cc1cc(C(F)(F)F)cc(-c2ccccc2)c1O)C(=O)Oc1ccccn1.
What is the InChIKey of pyridin-2-yl N-[[2-hydroxy-3-phenyl-5-(trifluoromethyl)phenyl]methyl]-N-methylcarbamate?
The InChIKey is MCVDFTPBQOMKFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17F3N2O3/c1-26(20(28)29-18-9-5-6-10-25-18)13-15-11-16(21(22,23)24)12-17(19(15)27)14-7-3-2-4-8-14/h2-12,27H,13H2,1H3.
What are the key properties of pyridin-2-yl N-[[2-hydroxy-3-phenyl-5-(trifluoromethyl)phenyl]methyl]-N-methylcarbamate?
pyridin-2-yl N-[[2-hydroxy-3-phenyl-5-(trifluoromethyl)phenyl]methyl]-N-methylcarbamate has a molecular weight of 402.37 g/mol, XLogP of 5.10, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-yl N-[[2-hydroxy-3-phenyl-5-(trifluoromethyl)phenyl]methyl]-N-methylcarbamate is sourced from PubChem (CID 68737859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).