C22H22N6O2 — CID 68737902
3-benzyl-5-(1H-indazol-5-yl)-N-(oxolan-3-ylmethyl)triazole-4-carboxamide (PubChem CID 68737902) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 3-benzyl-5-(1H-indazol-5-yl)-N-(oxolan-3-ylmethyl)triazole-4-carboxamide.
| Compound Name | 3-benzyl-5-(1H-indazol-5-yl)-N-(oxolan-3-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 68737902 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 3-benzyl-5-(1H-indazol-5-yl)-N-(oxolan-3-ylmethyl)triazole-4-carboxamide |
| SMILES | O=C(NCC1CCOC1)c1c(-c2ccc3[nH]ncc3c2)nnn1Cc1ccccc1 |
| InChI | InChI=1S/C22H22N6O2/c29-22(23-11-16-8-9-30-14-16)21-20(17-6-7-19-18(10-17)12-24-25-19)26-27-28(21)13-15-4-2-1-3-5-15/h1-7,10,12,16H,8-9,11,13-14H2,(H,23,29)(H,24,25) |
| InChIKey | PYVROCXEBLKGQO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |