About 5-bromo-3,4-dihydro-2H-pyrano[2,3-c]pyridine
5-bromo-3,4-dihydro-2H-pyrano[2,3-c]pyridine (PubChem CID 68737919) has the molecular formula C8H8BrNO
and a molecular weight of 214.06 g/mol. Its IUPAC name is 5-bromo-3,4-dihydro-2H-pyrano[2,3-c]pyridine.
Molecular Properties
| Compound Name | 5-bromo-3,4-dihydro-2H-pyrano[2,3-c]pyridine |
| PubChem CID | 68737919 |
| Molecular Formula | C8H8BrNO |
| Molecular Weight | 214.06 g/mol |
| Exact Mass | 212.98 |
| IUPAC Name | 5-bromo-3,4-dihydro-2H-pyrano[2,3-c]pyridine |
| SMILES | Brc1cncc2c1CCCO2 |
| InChI | InChI=1S/C8H8BrNO/c9-7-4-10-5-8-6(7)2-1-3-11-8/h4-5H,1-3H2 |
| InChIKey | CYHUILOIZFHIKS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.06 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-3,4-dihydro-2H-pyrano[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3,4-dihydro-2H-pyrano[2,3-c]pyridine?
The IUPAC name of 5-bromo-3,4-dihydro-2H-pyrano[2,3-c]pyridine (CID 68737919) is 5-bromo-3,4-dihydro-2H-pyrano[2,3-c]pyridine.
What is the SMILES notation for 5-bromo-3,4-dihydro-2H-pyrano[2,3-c]pyridine?
The canonical SMILES for 5-bromo-3,4-dihydro-2H-pyrano[2,3-c]pyridine is Brc1cncc2c1CCCO2.
What is the InChIKey of 5-bromo-3,4-dihydro-2H-pyrano[2,3-c]pyridine?
The InChIKey is CYHUILOIZFHIKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO/c9-7-4-10-5-8-6(7)2-1-3-11-8/h4-5H,1-3H2.
What are the key properties of 5-bromo-3,4-dihydro-2H-pyrano[2,3-c]pyridine?
5-bromo-3,4-dihydro-2H-pyrano[2,3-c]pyridine has a molecular weight of 214.06 g/mol, XLogP of 2.17, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3,4-dihydro-2H-pyrano[2,3-c]pyridine is sourced from PubChem (CID 68737919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).