2-(1,2-dihydroquinoxalin-2-yl)acetic acid

C10H10N2O2 — CID 68738150

IUPAC2-(1,2-dihydroquinoxalin-2-yl)acetic acid
SMILESO=C(O)CC1C=Nc2ccccc2N1
InChIInChI=1S/C10H10N2O2/c13-10(14)5-7-6-11-8-3-1-2-4-9(8)12-7/h1-4,6-7,12H,5H2,(H,13,14)
InChIKeyLHWXULHBZAZYLH-UHFFFAOYSA-N
MW190.20 g/mol
LogP1.66
Rot. Bonds2

About 2-(1,2-dihydroquinoxalin-2-yl)acetic acid

2-(1,2-dihydroquinoxalin-2-yl)acetic acid (PubChem CID 68738150) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 2-(1,2-dihydroquinoxalin-2-yl)acetic acid.

Molecular Properties

Compound Name2-(1,2-dihydroquinoxalin-2-yl)acetic acid
PubChem CID68738150
Molecular FormulaC10H10N2O2
Molecular Weight190.20 g/mol
Exact Mass190.07
IUPAC Name2-(1,2-dihydroquinoxalin-2-yl)acetic acid
SMILESO=C(O)CC1C=Nc2ccccc2N1
InChIInChI=1S/C10H10N2O2/c13-10(14)5-7-6-11-8-3-1-2-4-9(8)12-7/h1-4,6-7,12H,5H2,(H,13,14)
InChIKeyLHWXULHBZAZYLH-UHFFFAOYSA-N
XLogP1.66
TPSA61.69 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.20
LogP ≤ 51.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(1,2-dihydroquinoxalin-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,2-dihydroquinoxalin-2-yl)acetic acid?
The IUPAC name of 2-(1,2-dihydroquinoxalin-2-yl)acetic acid (CID 68738150) is 2-(1,2-dihydroquinoxalin-2-yl)acetic acid.
What is the SMILES notation for 2-(1,2-dihydroquinoxalin-2-yl)acetic acid?
The canonical SMILES for 2-(1,2-dihydroquinoxalin-2-yl)acetic acid is O=C(O)CC1C=Nc2ccccc2N1.
What is the InChIKey of 2-(1,2-dihydroquinoxalin-2-yl)acetic acid?
The InChIKey is LHWXULHBZAZYLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c13-10(14)5-7-6-11-8-3-1-2-4-9(8)12-7/h1-4,6-7,12H,5H2,(H,13,14).
What are the key properties of 2-(1,2-dihydroquinoxalin-2-yl)acetic acid?
2-(1,2-dihydroquinoxalin-2-yl)acetic acid has a molecular weight of 190.20 g/mol, XLogP of 1.66, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-dihydroquinoxalin-2-yl)acetic acid is sourced from PubChem (CID 68738150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).