C30H30ClN3O3S — CID 68738545
3-[4-[9-(benzenesulfonyl)-4-chloropyrido[2,3-b]indol-6-yl]phenoxy]-N,N-diethylpropan-1-amine (PubChem CID 68738545) has the molecular formula C30H30ClN3O3S and a molecular weight of 548.11 g/mol. Its IUPAC name is 3-[4-[9-(benzenesulfonyl)-4-chloropyrido[2,3-b]indol-6-yl]phenoxy]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[4-[9-(benzenesulfonyl)-4-chloropyrido[2,3-b]indol-6-yl]phenoxy]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 68738545 |
| Molecular Formula | C30H30ClN3O3S |
| Molecular Weight | 548.11 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | 3-[4-[9-(benzenesulfonyl)-4-chloropyrido[2,3-b]indol-6-yl]phenoxy]-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCCOc1ccc(-c2ccc3c(c2)c2c(Cl)ccnc2n3S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H30ClN3O3S/c1-3-33(4-2)19-8-20-37-24-14-11-22(12-15-24)23-13-16-28-26(21-23)29-27(31)17-18-32-30(29)34(28)38(35,36)25-9-6-5-7-10-25/h5-7,9-18,21H,3-4,8,19-20H2,1-2H3 |
| InChIKey | PLGDGHXNQLQLSK-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.11 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|